About 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one
5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one (PubChem CID 11841206) has the molecular formula C13H13N3OS
and a molecular weight of 259.33 g/mol. Its IUPAC name is 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one.
Molecular Properties
| Compound Name | 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one |
| PubChem CID | 11841206 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one |
| SMILES | Cc1cc(C)n2[nH]c(=O)c(Cc3cccs3)c2n1 |
| InChI | InChI=1S/C13H13N3OS/c1-8-6-9(2)16-12(14-8)11(13(17)15-16)7-10-4-3-5-18-10/h3-6H,7H2,1-2H3,(H,15,17) |
| InChIKey | CJTYGRAGKGOLJG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one?
The IUPAC name of 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one (CID 11841206) is 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one.
What is the SMILES notation for 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one?
The canonical SMILES for 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one is Cc1cc(C)n2[nH]c(=O)c(Cc3cccs3)c2n1.
What is the InChIKey of 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one?
The InChIKey is CJTYGRAGKGOLJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3OS/c1-8-6-9(2)16-12(14-8)11(13(17)15-16)7-10-4-3-5-18-10/h3-6H,7H2,1-2H3,(H,15,17).
What are the key properties of 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one?
5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one has a molecular weight of 259.33 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-3-(thiophen-2-ylmethyl)-1H-pyrazolo[1,5-a]pyrimidin-2-one is sourced from PubChem (CID 11841206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).