C24H22F3N3OS — CID 118412273
3-[4-(2,5-difluoroanilino)-5-methyl-6-sulfanylidene-1H-pyridin-3-yl]-4-(4-fluorophenyl)piperidine-1-carbaldehyde (PubChem CID 118412273) has the molecular formula C24H22F3N3OS and a molecular weight of 457.52 g/mol. Its IUPAC name is 3-[4-(2,5-difluoroanilino)-5-methyl-6-sulfanylidene-1H-pyridin-3-yl]-4-(4-fluorophenyl)piperidine-1-carbaldehyde.
| Compound Name | 3-[4-(2,5-difluoroanilino)-5-methyl-6-sulfanylidene-1H-pyridin-3-yl]-4-(4-fluorophenyl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 118412273 |
| Molecular Formula | C24H22F3N3OS |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 3-[4-(2,5-difluoroanilino)-5-methyl-6-sulfanylidene-1H-pyridin-3-yl]-4-(4-fluorophenyl)piperidine-1-carbaldehyde |
| SMILES | Cc1c(Nc2cc(F)ccc2F)c(C2CN(C=O)CCC2c2ccc(F)cc2)c[nH]c1=S |
| InChI | InChI=1S/C24H22F3N3OS/c1-14-23(29-22-10-17(26)6-7-21(22)27)19(11-28-24(14)32)20-12-30(13-31)9-8-18(20)15-2-4-16(25)5-3-15/h2-7,10-11,13,18,20H,8-9,12H2,1H3,(H2,28,29,32) |
| InChIKey | IUIWTXXDKJAGCO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|