About 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole
3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole (PubChem CID 118412817) has the molecular formula C3H2N6S
and a molecular weight of 154.16 g/mol. Its IUPAC name is 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole |
| PubChem CID | 118412817 |
| Molecular Formula | C3H2N6S |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.01 |
| IUPAC Name | 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole |
| SMILES | c1nc(-c2nn[nH]n2)ns1 |
| InChI | InChI=1S/C3H2N6S/c1-4-2(7-10-1)3-5-8-9-6-3/h1H,(H,5,6,8,9) |
| InChIKey | PCPZHKZHDBXNMY-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole?
The IUPAC name of 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole (CID 118412817) is 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole.
What is the SMILES notation for 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole?
The canonical SMILES for 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole is c1nc(-c2nn[nH]n2)ns1.
What is the InChIKey of 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole?
The InChIKey is PCPZHKZHDBXNMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N6S/c1-4-2(7-10-1)3-5-8-9-6-3/h1H,(H,5,6,8,9).
What are the key properties of 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole?
3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole has a molecular weight of 154.16 g/mol, XLogP of -0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2H-tetrazol-5-yl)-1,2,4-thiadiazole is sourced from PubChem (CID 118412817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).