C30H32F2O7S — CID 118413478
[(2R,3S,4S,5R,6R)-2-ethylsulfanyl-6-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]-5-phenylmethoxyoxan-3-yl] 2,5-difluorobenzoate (PubChem CID 118413478) has the molecular formula C30H32F2O7S and a molecular weight of 574.64 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-2-ethylsulfanyl-6-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]-5-phenylmethoxyoxan-3-yl] 2,5-difluorobenzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-2-ethylsulfanyl-6-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]-5-phenylmethoxyoxan-3-yl] 2,5-difluorobenzoate |
|---|---|
| PubChem CID | 118413478 |
| Molecular Formula | C30H32F2O7S |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-2-ethylsulfanyl-6-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]-5-phenylmethoxyoxan-3-yl] 2,5-difluorobenzoate |
| SMILES | CCS[C@H]1O[C@H](CO)[C@@H](OCc2ccccc2)[C@H](OCc2ccc(OC)cc2)[C@@H]1OC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C30H32F2O7S/c1-3-40-30-28(39-29(34)23-15-21(31)11-14-24(23)32)27(37-18-20-9-12-22(35-2)13-10-20)26(25(16-33)38-30)36-17-19-7-5-4-6-8-19/h4-15,25-28,30,33H,3,16-18H2,1-2H3/t25-,26-,27+,28+,30-/m1/s1 |
| InChIKey | ORRRTDGNEHAULO-NQPVIYSZSA-N |
| XLogP | 5.14 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |