C14H22N2O — CID 118413847
2-(3,3,5,5-tetramethylcyclohexyl)pyridazin-3-one (PubChem CID 118413847) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-(3,3,5,5-tetramethylcyclohexyl)pyridazin-3-one.
| Compound Name | 2-(3,3,5,5-tetramethylcyclohexyl)pyridazin-3-one |
|---|---|
| PubChem CID | 118413847 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-(3,3,5,5-tetramethylcyclohexyl)pyridazin-3-one |
| SMILES | CC1(C)CC(n2ncccc2=O)CC(C)(C)C1 |
| InChI | InChI=1S/C14H22N2O/c1-13(2)8-11(9-14(3,4)10-13)16-12(17)6-5-7-15-16/h5-7,11H,8-10H2,1-4H3 |
| InChIKey | CQIAXXWACDCMGX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |