About 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide
7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide (PubChem CID 118413945) has the molecular formula C19H23N3O4
and a molecular weight of 357.41 g/mol. Its IUPAC name is 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide.
Molecular Properties
| Compound Name | 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide |
| PubChem CID | 118413945 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide |
| SMILES | CCC[C@@H]1CC(=O)N[C@@H]1COc1nccc2cc(C(N)=O)c(OC)cc12 |
| InChI | InChI=1S/C19H23N3O4/c1-3-4-12-8-17(23)22-15(12)10-26-19-13-9-16(25-2)14(18(20)24)7-11(13)5-6-21-19/h5-7,9,12,15H,3-4,8,10H2,1-2H3,(H2,20,24)(H,22,23)/t12-,15-/m1/s1 |
| InChIKey | NOLFQBKTECYKHP-IUODEOHRSA-N |
| XLogP | 2.03 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide?
The IUPAC name of 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide (CID 118413945) is 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide.
What is the SMILES notation for 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide?
The canonical SMILES for 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide is CCC[C@@H]1CC(=O)N[C@@H]1COc1nccc2cc(C(N)=O)c(OC)cc12.
What is the InChIKey of 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide?
The InChIKey is NOLFQBKTECYKHP-IUODEOHRSA-N. The full InChI is InChI=1S/C19H23N3O4/c1-3-4-12-8-17(23)22-15(12)10-26-19-13-9-16(25-2)14(18(20)24)7-11(13)5-6-21-19/h5-7,9,12,15H,3-4,8,10H2,1-2H3,(H2,20,24)(H,22,23)/t12-,15-/m1/s1.
What are the key properties of 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide?
7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide has a molecular weight of 357.41 g/mol, XLogP of 2.03, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-1-[[(2S,3R)-5-oxo-3-propylpyrrolidin-2-yl]methoxy]isoquinoline-6-carboxamide is sourced from PubChem (CID 118413945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).