About 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide
6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide (PubChem CID 118414037) has the molecular formula C20H23N3O3
and a molecular weight of 353.42 g/mol. Its IUPAC name is 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide |
| PubChem CID | 118414037 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide |
| SMILES | CC(C)Cn1ccc2cc(-c3cc(C(N)=O)nc([C@H](O)CO)c3)ccc21 |
| InChI | InChI=1S/C20H23N3O3/c1-12(2)10-23-6-5-14-7-13(3-4-18(14)23)15-8-16(19(25)11-24)22-17(9-15)20(21)26/h3-9,12,19,24-25H,10-11H2,1-2H3,(H2,21,26)/t19-/m1/s1 |
| InChIKey | VZMVHFYKSVDNBC-LJQANCHMSA-N |
| XLogP | 2.48 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide?
The IUPAC name of 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide (CID 118414037) is 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide.
What is the SMILES notation for 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide?
The canonical SMILES for 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide is CC(C)Cn1ccc2cc(-c3cc(C(N)=O)nc([C@H](O)CO)c3)ccc21.
What is the InChIKey of 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide?
The InChIKey is VZMVHFYKSVDNBC-LJQANCHMSA-N. The full InChI is InChI=1S/C20H23N3O3/c1-12(2)10-23-6-5-14-7-13(3-4-18(14)23)15-8-16(19(25)11-24)22-17(9-15)20(21)26/h3-9,12,19,24-25H,10-11H2,1-2H3,(H2,21,26)/t19-/m1/s1.
What are the key properties of 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide?
6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide has a molecular weight of 353.42 g/mol, XLogP of 2.48, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1S)-1,2-dihydroxyethyl]-4-[1-(2-methylpropyl)indol-5-yl]pyridine-2-carboxamide is sourced from PubChem (CID 118414037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).