C10H17NO3 — CID 118414065
(7R,7aS)-7-(2-hydroxyethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 118414065) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (7R,7aS)-7-(2-hydroxyethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (7R,7aS)-7-(2-hydroxyethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 118414065 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (7R,7aS)-7-(2-hydroxyethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(C)OC[C@@H]2[C@H](CCO)CC(=O)N21 |
| InChI | InChI=1S/C10H17NO3/c1-10(2)11-8(6-14-10)7(3-4-12)5-9(11)13/h7-8,12H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | OTDSBLNRNGRRDH-HTQZYQBOSA-N |
| XLogP | 0.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |