C13H13BrFNO2 — CID 118414076
(3R,7R,7aS)-7-(bromomethyl)-6-fluoro-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 118414076) has the molecular formula C13H13BrFNO2 and a molecular weight of 314.15 g/mol. Its IUPAC name is (3R,7R,7aS)-7-(bromomethyl)-6-fluoro-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,7R,7aS)-7-(bromomethyl)-6-fluoro-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 118414076 |
| Molecular Formula | C13H13BrFNO2 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | (3R,7R,7aS)-7-(bromomethyl)-6-fluoro-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | O=C1C(F)[C@H](CBr)[C@H]2CO[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C13H13BrFNO2/c14-6-9-10-7-18-13(8-4-2-1-3-5-8)16(10)12(17)11(9)15/h1-5,9-11,13H,6-7H2/t9-,10-,11?,13-/m1/s1 |
| InChIKey | XZJPKAWELAKUHW-SQNVCAFISA-N |
| XLogP | 2.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|