C10H17NO3 — CID 118414302
(6R,7S,7aS)-6-methoxy-3,3,7-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 118414302) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (6R,7S,7aS)-6-methoxy-3,3,7-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6R,7S,7aS)-6-methoxy-3,3,7-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 118414302 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (6R,7S,7aS)-6-methoxy-3,3,7-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CO[C@H]1C(=O)N2[C@H](COC2(C)C)[C@@H]1C |
| InChI | InChI=1S/C10H17NO3/c1-6-7-5-14-10(2,3)11(7)9(12)8(6)13-4/h6-8H,5H2,1-4H3/t6-,7+,8+/m0/s1 |
| InChIKey | FXAZQRDKLUUIJF-XLPZGREQSA-N |
| XLogP | 0.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |