C9H14FNO2 — CID 118414393
(7R,7aS)-7-(fluoromethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 118414393) has the molecular formula C9H14FNO2 and a molecular weight of 187.21 g/mol. Its IUPAC name is (7R,7aS)-7-(fluoromethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (7R,7aS)-7-(fluoromethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 118414393 |
| Molecular Formula | C9H14FNO2 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (7R,7aS)-7-(fluoromethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(C)OC[C@@H]2[C@H](CF)CC(=O)N21 |
| InChI | InChI=1S/C9H14FNO2/c1-9(2)11-7(5-13-9)6(4-10)3-8(11)12/h6-7H,3-5H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | NJDLRVMWSQUIKF-NKWVEPMBSA-N |
| XLogP | 0.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |