C15H18FNO3 — CID 118414655
(3R,6R,7R,7aS)-7-ethyl-6-fluoro-3-(4-methoxyphenyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 118414655) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is (3R,6R,7R,7aS)-7-ethyl-6-fluoro-3-(4-methoxyphenyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,6R,7R,7aS)-7-ethyl-6-fluoro-3-(4-methoxyphenyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 118414655 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (3R,6R,7R,7aS)-7-ethyl-6-fluoro-3-(4-methoxyphenyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC[C@@H]1[C@H]2CO[C@H](c3ccc(OC)cc3)N2C(=O)[C@@H]1F |
| InChI | InChI=1S/C15H18FNO3/c1-3-11-12-8-20-15(17(12)14(18)13(11)16)9-4-6-10(19-2)7-5-9/h4-7,11-13,15H,3,8H2,1-2H3/t11-,12-,13-,15-/m1/s1 |
| InChIKey | BEYWDYKCTJSCHX-RGCMKSIDSA-N |
| XLogP | 2.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |