C10H16FNO2 — CID 118414672
(7S,7aS)-7-(2-fluoroethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 118414672) has the molecular formula C10H16FNO2 and a molecular weight of 201.24 g/mol. Its IUPAC name is (7S,7aS)-7-(2-fluoroethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (7S,7aS)-7-(2-fluoroethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 118414672 |
| Molecular Formula | C10H16FNO2 |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (7S,7aS)-7-(2-fluoroethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(C)OC[C@@H]2[C@H](CCF)CC(=O)N21 |
| InChI | InChI=1S/C10H16FNO2/c1-10(2)12-8(6-14-10)7(3-4-11)5-9(12)13/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | OLIQKJLIFLPJTP-HTQZYQBOSA-N |
| XLogP | 1.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |