C19H13F3N4O2 — CID 118414961
[(7R,8S)-3-cyano-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamic acid (PubChem CID 118414961) has the molecular formula C19H13F3N4O2 and a molecular weight of 386.33 g/mol. Its IUPAC name is [(7R,8S)-3-cyano-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamic acid.
| Compound Name | [(7R,8S)-3-cyano-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamic acid |
|---|---|
| PubChem CID | 118414961 |
| Molecular Formula | C19H13F3N4O2 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [(7R,8S)-3-cyano-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-yl]carbamic acid |
| SMILES | N#Cc1ccn2c3c(nc2c1)C[C@H](c1cc(F)c(F)cc1F)[C@@H](NC(=O)O)C3 |
| InChI | InChI=1S/C19H13F3N4O2/c20-12-6-14(22)13(21)4-10(12)11-5-16-17(7-15(11)25-19(27)28)26-2-1-9(8-23)3-18(26)24-16/h1-4,6,11,15,25H,5,7H2,(H,27,28)/t11-,15+/m1/s1 |
| InChIKey | KDYAFJPYXIICIV-ABAIWWIYSA-N |
| XLogP | 3.14 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|