C24H19Cl2N3O — CID 11841509
3-(2,6-dichlorophenyl)-2-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]quinazolin-4-one (PubChem CID 11841509) has the molecular formula C24H19Cl2N3O and a molecular weight of 436.34 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-2-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]quinazolin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-2-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 11841509 |
| Molecular Formula | C24H19Cl2N3O |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-2-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]quinazolin-4-one |
| SMILES | CN(C)c1ccc(/C=C\c2nc3ccccc3c(=O)n2-c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C24H19Cl2N3O/c1-28(2)17-13-10-16(11-14-17)12-15-22-27-21-9-4-3-6-18(21)24(30)29(22)23-19(25)7-5-8-20(23)26/h3-15H,1-2H3/b15-12- |
| InChIKey | ZNWKKBDFEGEAAG-QINSGFPZSA-N |
| XLogP | 5.93 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|