C18H22O2S — CID 11841571
(3aS,3bR,9bS,11aS)-7-methoxy-11a-methyl-2,3,3a,3b,4,9b,10,11-octahydroindeno[4,5-c]thiochromen-1-one (PubChem CID 11841571) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is (3aS,3bR,9bS,11aS)-7-methoxy-11a-methyl-2,3,3a,3b,4,9b,10,11-octahydroindeno[4,5-c]thiochromen-1-one.
| Compound Name | (3aS,3bR,9bS,11aS)-7-methoxy-11a-methyl-2,3,3a,3b,4,9b,10,11-octahydroindeno[4,5-c]thiochromen-1-one |
|---|---|
| PubChem CID | 11841571 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (3aS,3bR,9bS,11aS)-7-methoxy-11a-methyl-2,3,3a,3b,4,9b,10,11-octahydroindeno[4,5-c]thiochromen-1-one |
| SMILES | COc1ccc2c(c1)SC[C@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C18H22O2S/c1-18-8-7-12-13-4-3-11(20-2)9-16(13)21-10-14(12)15(18)5-6-17(18)19/h3-4,9,12,14-15H,5-8,10H2,1-2H3/t12-,14+,15+,18+/m1/s1 |
| InChIKey | RIICMZORHHQOBQ-FHIHXZLISA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |