C15H15N3O4 — CID 11841610
8-methyl-6-(4-nitrophenyl)-2,3-diazaspiro[4.5]dec-8-ene-1,4-dione (PubChem CID 11841610) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is 8-methyl-6-(4-nitrophenyl)-2,3-diazaspiro[4.5]dec-8-ene-1,4-dione.
| Compound Name | 8-methyl-6-(4-nitrophenyl)-2,3-diazaspiro[4.5]dec-8-ene-1,4-dione |
|---|---|
| PubChem CID | 11841610 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 8-methyl-6-(4-nitrophenyl)-2,3-diazaspiro[4.5]dec-8-ene-1,4-dione |
| SMILES | CC1=CCC2(C(=O)NNC2=O)C(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C15H15N3O4/c1-9-6-7-15(13(19)16-17-14(15)20)12(8-9)10-2-4-11(5-3-10)18(21)22/h2-6,12H,7-8H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | WRQAINOKCFFBDD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|