About (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate
(5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate (PubChem CID 11841639) has the molecular formula C14H14Cl2N2O3S
and a molecular weight of 361.25 g/mol. Its IUPAC name is (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate.
Molecular Properties
| Compound Name | (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate |
| PubChem CID | 11841639 |
| Molecular Formula | C14H14Cl2N2O3S |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate |
| SMILES | O=S(=O)(Oc1c(Cl)cc(Cl)c2cccnc12)N1CCCCC1 |
| InChI | InChI=1S/C14H14Cl2N2O3S/c15-11-9-12(16)14(13-10(11)5-4-6-17-13)21-22(19,20)18-7-2-1-3-8-18/h4-6,9H,1-3,7-8H2 |
| InChIKey | INXBEXRKXYBLGL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate?
The IUPAC name of (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate (CID 11841639) is (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate.
What is the SMILES notation for (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate?
The canonical SMILES for (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate is O=S(=O)(Oc1c(Cl)cc(Cl)c2cccnc12)N1CCCCC1.
What is the InChIKey of (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate?
The InChIKey is INXBEXRKXYBLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O3S/c15-11-9-12(16)14(13-10(11)5-4-6-17-13)21-22(19,20)18-7-2-1-3-8-18/h4-6,9H,1-3,7-8H2.
What are the key properties of (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate?
(5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate has a molecular weight of 361.25 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dichloroquinolin-8-yl) piperidine-1-sulfonate is sourced from PubChem (CID 11841639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).