C19H24N6O10P+ — CID 118416522
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]phosphorylamino]propanoate (PubChem CID 118416522) has the molecular formula C19H24N6O10P+ and a molecular weight of 527.41 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]phosphorylamino]propanoate.
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]phosphorylamino]propanoate |
|---|---|
| PubChem CID | 118416522 |
| Molecular Formula | C19H24N6O10P+ |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]phosphorylamino]propanoate |
| SMILES | O=C(CCNP(=O)(NCCN1C(=O)C=CC1=O)NCCN1C(=O)C=CC1=O)O[N+]1(O)C(=O)CCC1=O |
| InChI | InChI=1S/C19H24N6O10P/c26-13-1-2-14(27)23(13)11-9-21-36(34,22-10-12-24-15(28)3-4-16(24)29)20-8-7-19(32)35-25(33)17(30)5-6-18(25)31/h1-4,33H,5-12H2,(H3,20,21,22,34)/q+1 |
| InChIKey | YGILROATZVORRL-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 208.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|