About 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one
4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one (PubChem CID 11841809) has the molecular formula C16H12Cl2N4O2
and a molecular weight of 363.20 g/mol. Its IUPAC name is 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one.
Molecular Properties
| Compound Name | 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one |
| PubChem CID | 11841809 |
| Molecular Formula | C16H12Cl2N4O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one |
| SMILES | Cc1cc(C)cc(Oc2cc(-n3ncc(Cl)c(Cl)c3=O)ncn2)c1 |
| InChI | InChI=1S/C16H12Cl2N4O2/c1-9-3-10(2)5-11(4-9)24-14-6-13(19-8-20-14)22-16(23)15(18)12(17)7-21-22/h3-8H,1-2H3 |
| InChIKey | MTRIXOIUQOHIQP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one?
The IUPAC name of 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one (CID 11841809) is 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one.
What is the SMILES notation for 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one?
The canonical SMILES for 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one is Cc1cc(C)cc(Oc2cc(-n3ncc(Cl)c(Cl)c3=O)ncn2)c1.
What is the InChIKey of 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one?
The InChIKey is MTRIXOIUQOHIQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2N4O2/c1-9-3-10(2)5-11(4-9)24-14-6-13(19-8-20-14)22-16(23)15(18)12(17)7-21-22/h3-8H,1-2H3.
What are the key properties of 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one?
4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one has a molecular weight of 363.20 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-[6-(3,5-dimethylphenoxy)pyrimidin-4-yl]pyridazin-3-one is sourced from PubChem (CID 11841809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).