About N'-butyl-4-(2,3-difluorophenyl)benzohydrazide
N'-butyl-4-(2,3-difluorophenyl)benzohydrazide (PubChem CID 118418385) has the molecular formula C17H18F2N2O
and a molecular weight of 304.34 g/mol. Its IUPAC name is N'-butyl-4-(2,3-difluorophenyl)benzohydrazide.
Molecular Properties
| Compound Name | N'-butyl-4-(2,3-difluorophenyl)benzohydrazide |
| PubChem CID | 118418385 |
| Molecular Formula | C17H18F2N2O |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N'-butyl-4-(2,3-difluorophenyl)benzohydrazide |
| SMILES | CCCCNNC(=O)c1ccc(-c2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C17H18F2N2O/c1-2-3-11-20-21-17(22)13-9-7-12(8-10-13)14-5-4-6-15(18)16(14)19/h4-10,20H,2-3,11H2,1H3,(H,21,22) |
| InChIKey | OSQKWTZHYXRTBG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-butyl-4-(2,3-difluorophenyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butyl-4-(2,3-difluorophenyl)benzohydrazide?
The IUPAC name of N'-butyl-4-(2,3-difluorophenyl)benzohydrazide (CID 118418385) is N'-butyl-4-(2,3-difluorophenyl)benzohydrazide.
What is the SMILES notation for N'-butyl-4-(2,3-difluorophenyl)benzohydrazide?
The canonical SMILES for N'-butyl-4-(2,3-difluorophenyl)benzohydrazide is CCCCNNC(=O)c1ccc(-c2cccc(F)c2F)cc1.
What is the InChIKey of N'-butyl-4-(2,3-difluorophenyl)benzohydrazide?
The InChIKey is OSQKWTZHYXRTBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F2N2O/c1-2-3-11-20-21-17(22)13-9-7-12(8-10-13)14-5-4-6-15(18)16(14)19/h4-10,20H,2-3,11H2,1H3,(H,21,22).
What are the key properties of N'-butyl-4-(2,3-difluorophenyl)benzohydrazide?
N'-butyl-4-(2,3-difluorophenyl)benzohydrazide has a molecular weight of 304.34 g/mol, XLogP of 3.67, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butyl-4-(2,3-difluorophenyl)benzohydrazide is sourced from PubChem (CID 118418385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).