C24H31N5O2S2 — CID 118418559
N-[(4-aminophenyl)methyl]-N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 118418559) has the molecular formula C24H31N5O2S2 and a molecular weight of 485.68 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[(4-aminophenyl)methyl]-N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 118418559 |
| Molecular Formula | C24H31N5O2S2 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(N(Cc3ccc(N)cc3)C(=O)C3CCNCC3)s2)o1 |
| InChI | InChI=1S/C24H31N5O2S2/c1-24(2,3)19-12-27-20(31-19)15-32-21-13-28-23(33-21)29(14-16-4-6-18(25)7-5-16)22(30)17-8-10-26-11-9-17/h4-7,12-13,17,26H,8-11,14-15,25H2,1-3H3 |
| InChIKey | XRYDXJCCGHJAJW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|