C15H18N4O2S — CID 118418588
N-(propylcarbamoyl)-2-quinoxalin-2-ylsulfanylpropanamide (PubChem CID 118418588) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(propylcarbamoyl)-2-quinoxalin-2-ylsulfanylpropanamide.
| Compound Name | N-(propylcarbamoyl)-2-quinoxalin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 118418588 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(propylcarbamoyl)-2-quinoxalin-2-ylsulfanylpropanamide |
| SMILES | CCCNC(=O)NC(=O)C(C)Sc1cnc2ccccc2n1 |
| InChI | InChI=1S/C15H18N4O2S/c1-3-8-16-15(21)19-14(20)10(2)22-13-9-17-11-6-4-5-7-12(11)18-13/h4-7,9-10H,3,8H2,1-2H3,(H2,16,19,20,21) |
| InChIKey | OISRYUWRRCRRCV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |