C8H6F8N4O — CID 118418742
1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbohydrazide (PubChem CID 118418742) has the molecular formula C8H6F8N4O and a molecular weight of 326.15 g/mol. Its IUPAC name is 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbohydrazide.
| Compound Name | 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 118418742 |
| Molecular Formula | C8H6F8N4O |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbohydrazide |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1C(=O)NN |
| InChI | InChI=1S/C8H6F8N4O/c1-20-3(5(21)18-17)2(7(11,12)13)4(19-20)6(9,10)8(14,15)16/h17H2,1H3,(H,18,21) |
| InChIKey | ILJAFYJHMJBSEG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|