C19H14ClF2N5O3 — CID 118418999
1-[4-[(2-chloro-3,6-difluorobenzoyl)amino]phenyl]-4-N-methylimidazole-4,5-dicarboxamide (PubChem CID 118418999) has the molecular formula C19H14ClF2N5O3 and a molecular weight of 433.80 g/mol. Its IUPAC name is 1-[4-[(2-chloro-3,6-difluorobenzoyl)amino]phenyl]-4-N-methylimidazole-4,5-dicarboxamide.
| Compound Name | 1-[4-[(2-chloro-3,6-difluorobenzoyl)amino]phenyl]-4-N-methylimidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 118418999 |
| Molecular Formula | C19H14ClF2N5O3 |
| Molecular Weight | 433.80 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 1-[4-[(2-chloro-3,6-difluorobenzoyl)amino]phenyl]-4-N-methylimidazole-4,5-dicarboxamide |
| SMILES | CNC(=O)c1ncn(-c2ccc(NC(=O)c3c(F)ccc(F)c3Cl)cc2)c1C(N)=O |
| InChI | InChI=1S/C19H14ClF2N5O3/c1-24-19(30)15-16(17(23)28)27(8-25-15)10-4-2-9(3-5-10)26-18(29)13-11(21)6-7-12(22)14(13)20/h2-8H,1H3,(H2,23,28)(H,24,30)(H,26,29) |
| InChIKey | OVSCXMBASZEVBO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.80 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|