About N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide
N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide (PubChem CID 11841933) has the molecular formula C15H13F3N2O2S
and a molecular weight of 342.34 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide.
Molecular Properties
| Compound Name | N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide |
| PubChem CID | 11841933 |
| Molecular Formula | C15H13F3N2O2S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide |
| SMILES | CN(/C(=N\S(=O)(=O)c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H13F3N2O2S/c1-20(12-8-4-2-5-9-12)14(15(16,17)18)19-23(21,22)13-10-6-3-7-11-13/h2-11H,1H3/b19-14- |
| InChIKey | QXSIAMYYYLVOPV-RGEXLXHISA-N |
| XLogP | 3.47 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide?
The IUPAC name of N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide (CID 11841933) is N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide.
What is the SMILES notation for N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide?
The canonical SMILES for N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide is CN(/C(=N\S(=O)(=O)c1ccccc1)C(F)(F)F)c1ccccc1.
What is the InChIKey of N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide?
The InChIKey is QXSIAMYYYLVOPV-RGEXLXHISA-N. The full InChI is InChI=1S/C15H13F3N2O2S/c1-20(12-8-4-2-5-9-12)14(15(16,17)18)19-23(21,22)13-10-6-3-7-11-13/h2-11H,1H3/b19-14-.
What are the key properties of N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide?
N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide has a molecular weight of 342.34 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide is sourced from PubChem (CID 11841933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).