(3S)-3-fluoropiperidine-1-carboxylic acid

C6H10FNO2 — CID 118419771

IUPAC(3S)-3-fluoropiperidine-1-carboxylic acid
SMILESO=C(O)N1CCC[C@H](F)C1
InChIInChI=1S/C6H10FNO2/c7-5-2-1-3-8(4-5)6(9)10/h5H,1-4H2,(H,9,10)/t5-/m0/s1
InChIKeySSADGUBPPQGXAO-YFKPBYRVSA-N
MW147.15 g/mol
LogP1.10
Rot. Bonds

About (3S)-3-fluoropiperidine-1-carboxylic acid

(3S)-3-fluoropiperidine-1-carboxylic acid (PubChem CID 118419771) has the molecular formula C6H10FNO2 and a molecular weight of 147.15 g/mol. Its IUPAC name is (3S)-3-fluoropiperidine-1-carboxylic acid.

Molecular Properties

Compound Name(3S)-3-fluoropiperidine-1-carboxylic acid
PubChem CID118419771
Molecular FormulaC6H10FNO2
Molecular Weight147.15 g/mol
Exact Mass147.07
IUPAC Name(3S)-3-fluoropiperidine-1-carboxylic acid
SMILESO=C(O)N1CCC[C@H](F)C1
InChIInChI=1S/C6H10FNO2/c7-5-2-1-3-8(4-5)6(9)10/h5H,1-4H2,(H,9,10)/t5-/m0/s1
InChIKeySSADGUBPPQGXAO-YFKPBYRVSA-N
XLogP1.10
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.15
LogP ≤ 51.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (3S)-3-fluoropiperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Piperidine-1-carboxylic acid
CID 9964094
Methyl piperidine carboxylic acid
CID 10307867
Piperidine carboxylate
CID 21874245
(2R)-2-methylpiperidine-1-carboxylic acid
CID 54114667
Piperidine-car-boxylic acid monohydrate
CID 67843925
4-(Trifluoromethyl)piperidine-1-carboxylic acid
CID 22283359
4,4-Difluoropiperidine-1-carboxylic acid
CID 22741696
4-Fluoropiperidine-1-carboxylic acid
CID 23090127
2-Fluoropiperidine-1-carboxylic acid
CID 23110097
4-(Fluoromethyl)piperidine-1-carboxylic acid
CID 23110117
4-(2-Fluoroethyl)piperidine-1-carboxylic acid
CID 53973245
3,3-Difluoropiperidine-1-carboxylic acid
CID 57465555

Frequently Asked Questions

What is the IUPAC name of (3S)-3-fluoropiperidine-1-carboxylic acid?
The IUPAC name of (3S)-3-fluoropiperidine-1-carboxylic acid (CID 118419771) is (3S)-3-fluoropiperidine-1-carboxylic acid.
What is the SMILES notation for (3S)-3-fluoropiperidine-1-carboxylic acid?
The canonical SMILES for (3S)-3-fluoropiperidine-1-carboxylic acid is O=C(O)N1CCC[C@H](F)C1.
What is the InChIKey of (3S)-3-fluoropiperidine-1-carboxylic acid?
The InChIKey is SSADGUBPPQGXAO-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H10FNO2/c7-5-2-1-3-8(4-5)6(9)10/h5H,1-4H2,(H,9,10)/t5-/m0/s1.
What are the key properties of (3S)-3-fluoropiperidine-1-carboxylic acid?
(3S)-3-fluoropiperidine-1-carboxylic acid has a molecular weight of 147.15 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-fluoropiperidine-1-carboxylic acid is sourced from PubChem (CID 118419771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).