About 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine
5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine (PubChem CID 118419790) has the molecular formula C13H21ClN2O
and a molecular weight of 256.78 g/mol. Its IUPAC name is 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine |
| PubChem CID | 118419790 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine |
| SMILES | Cc1cc(Cl)ncc1OCC(C)CC(C)(C)N |
| InChI | InChI=1S/C13H21ClN2O/c1-9(6-13(3,4)15)8-17-11-7-16-12(14)5-10(11)2/h5,7,9H,6,8,15H2,1-4H3 |
| InChIKey | XEUXNUUWFIPJAH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine?
The IUPAC name of 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine (CID 118419790) is 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine.
What is the SMILES notation for 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine?
The canonical SMILES for 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine is Cc1cc(Cl)ncc1OCC(C)CC(C)(C)N.
What is the InChIKey of 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine?
The InChIKey is XEUXNUUWFIPJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN2O/c1-9(6-13(3,4)15)8-17-11-7-16-12(14)5-10(11)2/h5,7,9H,6,8,15H2,1-4H3.
What are the key properties of 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine?
5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine has a molecular weight of 256.78 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-chloro-4-methyl-3-pyridinyl)oxy]-2,4-dimethylpentan-2-amine is sourced from PubChem (CID 118419790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).