C18H23ClFN3O — CID 118419797
(2S)-1-[[6-(2-chloro-4-pyridinyl)-5-fluoro-2-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine (PubChem CID 118419797) has the molecular formula C18H23ClFN3O and a molecular weight of 351.85 g/mol. Its IUPAC name is (2S)-1-[[6-(2-chloro-4-pyridinyl)-5-fluoro-2-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine.
| Compound Name | (2S)-1-[[6-(2-chloro-4-pyridinyl)-5-fluoro-2-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 118419797 |
| Molecular Formula | C18H23ClFN3O |
| Molecular Weight | 351.85 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (2S)-1-[[6-(2-chloro-4-pyridinyl)-5-fluoro-2-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
| SMILES | Cc1nc(-c2ccnc(Cl)c2)c(F)cc1OC[C@@](C)(N)CC(C)C |
| InChI | InChI=1S/C18H23ClFN3O/c1-11(2)9-18(4,21)10-24-15-8-14(20)17(23-12(15)3)13-5-6-22-16(19)7-13/h5-8,11H,9-10,21H2,1-4H3/t18-/m0/s1 |
| InChIKey | YNQQBUMXCJWUHF-SFHVURJKSA-N |
| XLogP | 4.39 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.85 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|