About [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid
[4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid (PubChem CID 118420028) has the molecular formula C19H27FN4O3
and a molecular weight of 378.45 g/mol. Its IUPAC name is [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid.
Molecular Properties
| Compound Name | [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid |
| PubChem CID | 118420028 |
| Molecular Formula | C19H27FN4O3 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid |
| SMILES | CC1=NC(c2ccnc(NC(=O)O)c2)=CCC1(F)OCC(C)(N)CC(C)C |
| InChI | InChI=1S/C19H27FN4O3/c1-12(2)10-18(4,21)11-27-19(20)7-5-15(23-13(19)3)14-6-8-22-16(9-14)24-17(25)26/h5-6,8-9,12H,7,10-11,21H2,1-4H3,(H,22,24)(H,25,26) |
| InChIKey | FXWPQJGHNZGXKL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid?
The IUPAC name of [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid (CID 118420028) is [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid.
What is the SMILES notation for [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid?
The canonical SMILES for [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid is CC1=NC(c2ccnc(NC(=O)O)c2)=CCC1(F)OCC(C)(N)CC(C)C.
What is the InChIKey of [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid?
The InChIKey is FXWPQJGHNZGXKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27FN4O3/c1-12(2)10-18(4,21)11-27-19(20)7-5-15(23-13(19)3)14-6-8-22-16(9-14)24-17(25)26/h5-6,8-9,12H,7,10-11,21H2,1-4H3,(H,22,24)(H,25,26).
What are the key properties of [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid?
[4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid has a molecular weight of 378.45 g/mol, XLogP of 3.82, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-(2-amino-2,4-dimethylpentoxy)-5-fluoro-6-methyl-4H-pyridin-2-yl]-2-pyridinyl]carbamic acid is sourced from PubChem (CID 118420028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).