About (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine
(2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine (PubChem CID 118420203) has the molecular formula C19H23F3N2O
and a molecular weight of 352.40 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine.
Molecular Properties
| Compound Name | (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine |
| PubChem CID | 118420203 |
| Molecular Formula | C19H23F3N2O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine |
| SMILES | CC(C)C[C@](C)(N)COc1ccc(-c2ccncc2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H23F3N2O/c1-13(2)11-18(3,23)12-25-17-5-4-15(10-16(17)19(20,21)22)14-6-8-24-9-7-14/h4-10,13H,11-12,23H2,1-3H3/t18-/m0/s1 |
| InChIKey | UJFBQMHGCCSHRP-SFHVURJKSA-N |
| XLogP | 4.91 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
The IUPAC name of (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine (CID 118420203) is (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine.
What is the SMILES notation for (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
The canonical SMILES for (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine is CC(C)C[C@](C)(N)COc1ccc(-c2ccncc2)cc1C(F)(F)F.
What is the InChIKey of (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
The InChIKey is UJFBQMHGCCSHRP-SFHVURJKSA-N. The full InChI is InChI=1S/C19H23F3N2O/c1-13(2)11-18(3,23)12-25-17-5-4-15(10-16(17)19(20,21)22)14-6-8-24-9-7-14/h4-10,13H,11-12,23H2,1-3H3/t18-/m0/s1.
What are the key properties of (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
(2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine has a molecular weight of 352.40 g/mol, XLogP of 4.91, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,4-dimethyl-1-[4-pyridin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine is sourced from PubChem (CID 118420203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).