About (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine
(2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine (PubChem CID 118420260) has the molecular formula C17H23ClN4O
and a molecular weight of 334.85 g/mol. Its IUPAC name is (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
| PubChem CID | 118420260 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
| SMILES | Cc1nccc(-c2cnc(OC[C@@](C)(N)CC(C)C)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H23ClN4O/c1-11(2)8-17(4,19)10-23-16-14(18)7-13(9-21-16)15-5-6-20-12(3)22-15/h5-7,9,11H,8,10,19H2,1-4H3/t17-/m0/s1 |
| InChIKey | ASPJNLYWGAKLTB-KRWDZBQOSA-N |
| XLogP | 3.64 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine?
The IUPAC name of (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine (CID 118420260) is (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine.
What is the SMILES notation for (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine?
The canonical SMILES for (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine is Cc1nccc(-c2cnc(OC[C@@](C)(N)CC(C)C)c(Cl)c2)n1.
What is the InChIKey of (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine?
The InChIKey is ASPJNLYWGAKLTB-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H23ClN4O/c1-11(2)8-17(4,19)10-23-16-14(18)7-13(9-21-16)15-5-6-20-12(3)22-15/h5-7,9,11H,8,10,19H2,1-4H3/t17-/m0/s1.
What are the key properties of (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine?
(2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine has a molecular weight of 334.85 g/mol, XLogP of 3.64, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[[3-chloro-5-(2-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine is sourced from PubChem (CID 118420260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).