C19H24ClN3O2 — CID 118420290
N-[4-[4-[(2S)-2-amino-4-methylpentoxy]-3-chlorophenyl]-2-pyridinyl]acetamide (PubChem CID 118420290) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is N-[4-[4-[(2S)-2-amino-4-methylpentoxy]-3-chlorophenyl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[4-[(2S)-2-amino-4-methylpentoxy]-3-chlorophenyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 118420290 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[4-[4-[(2S)-2-amino-4-methylpentoxy]-3-chlorophenyl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2ccc(OC[C@@H](N)CC(C)C)c(Cl)c2)ccn1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-12(2)8-16(21)11-25-18-5-4-14(9-17(18)20)15-6-7-22-19(10-15)23-13(3)24/h4-7,9-10,12,16H,8,11,21H2,1-3H3,(H,22,23,24)/t16-/m0/s1 |
| InChIKey | DPKIBVXNSRPEDN-INIZCTEOSA-N |
| XLogP | 4.11 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |