About (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine
(2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine (PubChem CID 118420366) has the molecular formula C23H25F3N2O
and a molecular weight of 402.46 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine.
Molecular Properties
| Compound Name | (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine |
| PubChem CID | 118420366 |
| Molecular Formula | C23H25F3N2O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine |
| SMILES | CC(C)C[C@](C)(N)COc1ccc(-c2ccnc3ccccc23)cc1C(F)(F)F |
| InChI | InChI=1S/C23H25F3N2O/c1-15(2)13-22(3,27)14-29-21-9-8-16(12-19(21)23(24,25)26)17-10-11-28-20-7-5-4-6-18(17)20/h4-12,15H,13-14,27H2,1-3H3/t22-/m0/s1 |
| InChIKey | WLAZWTACSHXEGN-QFIPXVFZSA-N |
| XLogP | 6.06 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
The IUPAC name of (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine (CID 118420366) is (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine.
What is the SMILES notation for (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
The canonical SMILES for (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine is CC(C)C[C@](C)(N)COc1ccc(-c2ccnc3ccccc23)cc1C(F)(F)F.
What is the InChIKey of (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
The InChIKey is WLAZWTACSHXEGN-QFIPXVFZSA-N. The full InChI is InChI=1S/C23H25F3N2O/c1-15(2)13-22(3,27)14-29-21-9-8-16(12-19(21)23(24,25)26)17-10-11-28-20-7-5-4-6-18(17)20/h4-12,15H,13-14,27H2,1-3H3/t22-/m0/s1.
What are the key properties of (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
(2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine has a molecular weight of 402.46 g/mol, XLogP of 6.06, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,4-dimethyl-1-[4-quinolin-4-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine is sourced from PubChem (CID 118420366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).