About (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate
(4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate (PubChem CID 118420637) has the molecular formula C10H13NO4S
and a molecular weight of 243.28 g/mol. Its IUPAC name is (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate.
Molecular Properties
| Compound Name | (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate |
| PubChem CID | 118420637 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate |
| SMILES | COc1ccnc2c1CCC2OS(C)(=O)=O |
| InChI | InChI=1S/C10H13NO4S/c1-14-8-5-6-11-10-7(8)3-4-9(10)15-16(2,12)13/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | ATAZCCGXVDNSPQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate?
The IUPAC name of (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate (CID 118420637) is (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate.
What is the SMILES notation for (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate?
The canonical SMILES for (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate is COc1ccnc2c1CCC2OS(C)(=O)=O.
What is the InChIKey of (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate?
The InChIKey is ATAZCCGXVDNSPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S/c1-14-8-5-6-11-10-7(8)3-4-9(10)15-16(2,12)13/h5-6,9H,3-4H2,1-2H3.
What are the key properties of (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate?
(4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate has a molecular weight of 243.28 g/mol, XLogP of 1.05, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) methanesulfonate is sourced from PubChem (CID 118420637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).