C36H42ClN7O2 — CID 118420661
9-(7-azaspiro[3.5]nonan-2-yl)-6-N,6-N-dibenzyl-2-N-[4-(2-methoxyethoxy)phenyl]purine-2,6-diamine;hydrochloride (PubChem CID 118420661) has the molecular formula C36H42ClN7O2 and a molecular weight of 640.23 g/mol. Its IUPAC name is 9-(7-azaspiro[3.5]nonan-2-yl)-6-N,6-N-dibenzyl-2-N-[4-(2-methoxyethoxy)phenyl]purine-2,6-diamine;hydrochloride.
| Compound Name | 9-(7-azaspiro[3.5]nonan-2-yl)-6-N,6-N-dibenzyl-2-N-[4-(2-methoxyethoxy)phenyl]purine-2,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 118420661 |
| Molecular Formula | C36H42ClN7O2 |
| Molecular Weight | 640.23 g/mol |
| Exact Mass | 639.31 |
| IUPAC Name | 9-(7-azaspiro[3.5]nonan-2-yl)-6-N,6-N-dibenzyl-2-N-[4-(2-methoxyethoxy)phenyl]purine-2,6-diamine;hydrochloride |
| SMILES | COCCOc1ccc(Nc2nc(N(Cc3ccccc3)Cc3ccccc3)c3ncn(C4CC5(CCNCC5)C4)c3n2)cc1.Cl |
| InChI | InChI=1S/C36H41N7O2.ClH/c1-44-20-21-45-31-14-12-29(13-15-31)39-35-40-33(42(24-27-8-4-2-5-9-27)25-28-10-6-3-7-11-28)32-34(41-35)43(26-38-32)30-22-36(23-30)16-18-37-19-17-36;/h2-15,26,30,37H,16-25H2,1H3,(H,39,40,41);1H |
| InChIKey | YOHXPFZCGMVDQV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.23 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|