About 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone
1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone (PubChem CID 11842091) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone |
| PubChem CID | 11842091 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone |
| SMILES | O=C(CC1CC(c2ccccc2)=NO1)c1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c19-17(14-9-5-2-6-10-14)12-15-11-16(18-20-15)13-7-3-1-4-8-13/h1-10,15H,11-12H2 |
| InChIKey | RGUZKBBCQJNISD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone?
The IUPAC name of 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone (CID 11842091) is 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone.
What is the SMILES notation for 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone?
The canonical SMILES for 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone is O=C(CC1CC(c2ccccc2)=NO1)c1ccccc1.
What is the InChIKey of 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone?
The InChIKey is RGUZKBBCQJNISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2/c19-17(14-9-5-2-6-10-14)12-15-11-16(18-20-15)13-7-3-1-4-8-13/h1-10,15H,11-12H2.
What are the key properties of 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone?
1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone has a molecular weight of 265.31 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone is sourced from PubChem (CID 11842091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).