C14H17NO2 — CID 11842166
1-phenyl-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one (PubChem CID 11842166) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-phenyl-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one.
| Compound Name | 1-phenyl-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 11842166 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-phenyl-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one |
| SMILES | O=C1COC(c2ccccc2)C2CCCCN12 |
| InChI | InChI=1S/C14H17NO2/c16-13-10-17-14(11-6-2-1-3-7-11)12-8-4-5-9-15(12)13/h1-3,6-7,12,14H,4-5,8-10H2 |
| InChIKey | DOMCFYUEFOEBGH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |