C14H19NO — CID 11842168
1-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine (PubChem CID 11842168) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine.
| Compound Name | 1-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 11842168 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine |
| SMILES | c1ccc(C2OCCN3CCCCC23)cc1 |
| InChI | InChI=1S/C14H19NO/c1-2-6-12(7-3-1)14-13-8-4-5-9-15(13)10-11-16-14/h1-3,6-7,13-14H,4-5,8-11H2 |
| InChIKey | NIBCANWBQBKMFI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |