C28H24N2O4S — CID 11842238
4-methyl-N-(4-oxo-3-phenoxy-1-phenylazetidin-2-yl)-N-phenylbenzenesulfonamide (PubChem CID 11842238) has the molecular formula C28H24N2O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is 4-methyl-N-(4-oxo-3-phenoxy-1-phenylazetidin-2-yl)-N-phenylbenzenesulfonamide.
| Compound Name | 4-methyl-N-(4-oxo-3-phenoxy-1-phenylazetidin-2-yl)-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 11842238 |
| Molecular Formula | C28H24N2O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 4-methyl-N-(4-oxo-3-phenoxy-1-phenylazetidin-2-yl)-N-phenylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccccc2)C2C(Oc3ccccc3)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2O4S/c1-21-17-19-25(20-18-21)35(32,33)30(23-13-7-3-8-14-23)27-26(34-24-15-9-4-10-16-24)28(31)29(27)22-11-5-2-6-12-22/h2-20,26-27H,1H3 |
| InChIKey | GVRHUEMPEFJHOH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |