C22H39N5O2 — CID 118422386
N-(3-hydroxypropyl)-2-[4-(1-propan-2-ylpiperidin-4-yl)-1,4-diazepan-1-yl]-1,2-dihydropyridine-6-carboxamide (PubChem CID 118422386) has the molecular formula C22H39N5O2 and a molecular weight of 405.59 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2-[4-(1-propan-2-ylpiperidin-4-yl)-1,4-diazepan-1-yl]-1,2-dihydropyridine-6-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-2-[4-(1-propan-2-ylpiperidin-4-yl)-1,4-diazepan-1-yl]-1,2-dihydropyridine-6-carboxamide |
|---|---|
| PubChem CID | 118422386 |
| Molecular Formula | C22H39N5O2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | N-(3-hydroxypropyl)-2-[4-(1-propan-2-ylpiperidin-4-yl)-1,4-diazepan-1-yl]-1,2-dihydropyridine-6-carboxamide |
| SMILES | CC(C)N1CCC(N2CCCN(C3C=CC=C(C(=O)NCCCO)N3)CC2)CC1 |
| InChI | InChI=1S/C22H39N5O2/c1-18(2)25-13-8-19(9-14-25)26-11-5-12-27(16-15-26)21-7-3-6-20(24-21)22(29)23-10-4-17-28/h3,6-7,18-19,21,24,28H,4-5,8-17H2,1-2H3,(H,23,29) |
| InChIKey | KAOBCGPBVMNTGS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|