C23H41N5O — CID 118422456
N-butyl-2-[4-(1-propan-2-ylpiperidin-4-yl)-1,4-diazepan-1-yl]-1,2-dihydropyridine-6-carboxamide (PubChem CID 118422456) has the molecular formula C23H41N5O and a molecular weight of 403.62 g/mol. Its IUPAC name is N-butyl-2-[4-(1-propan-2-ylpiperidin-4-yl)-1,4-diazepan-1-yl]-1,2-dihydropyridine-6-carboxamide.
| Compound Name | N-butyl-2-[4-(1-propan-2-ylpiperidin-4-yl)-1,4-diazepan-1-yl]-1,2-dihydropyridine-6-carboxamide |
|---|---|
| PubChem CID | 118422456 |
| Molecular Formula | C23H41N5O |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.33 |
| IUPAC Name | N-butyl-2-[4-(1-propan-2-ylpiperidin-4-yl)-1,4-diazepan-1-yl]-1,2-dihydropyridine-6-carboxamide |
| SMILES | CCCCNC(=O)C1=CC=CC(N2CCCN(C3CCN(C(C)C)CC3)CC2)N1 |
| InChI | InChI=1S/C23H41N5O/c1-4-5-12-24-23(29)21-8-6-9-22(25-21)28-14-7-13-27(17-18-28)20-10-15-26(16-11-20)19(2)3/h6,8-9,19-20,22,25H,4-5,7,10-18H2,1-3H3,(H,24,29) |
| InChIKey | MASPPBCWAUDIBE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|