C48H28F2N6 — CID 118422713
2-fluoro-9-[3-[9-[3-(9-fluoro-1,10-phenanthrolin-2-yl)phenyl]-5,6-dihydro-1,10-phenanthrolin-2-yl]phenyl]-1,10-phenanthroline (PubChem CID 118422713) has the molecular formula C48H28F2N6 and a molecular weight of 726.79 g/mol. Its IUPAC name is 2-fluoro-9-[3-[9-[3-(9-fluoro-1,10-phenanthrolin-2-yl)phenyl]-5,6-dihydro-1,10-phenanthrolin-2-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 2-fluoro-9-[3-[9-[3-(9-fluoro-1,10-phenanthrolin-2-yl)phenyl]-5,6-dihydro-1,10-phenanthrolin-2-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 118422713 |
| Molecular Formula | C48H28F2N6 |
| Molecular Weight | 726.79 g/mol |
| Exact Mass | 726.23 |
| IUPAC Name | 2-fluoro-9-[3-[9-[3-(9-fluoro-1,10-phenanthrolin-2-yl)phenyl]-5,6-dihydro-1,10-phenanthrolin-2-yl]phenyl]-1,10-phenanthroline |
| SMILES | Fc1ccc2ccc3ccc(-c4cccc(-c5ccc6c(n5)-c5nc(-c7cccc(-c8ccc9ccc%10ccc(F)nc%10c9n8)c7)ccc5CC6)c4)nc3c2n1 |
| InChI | InChI=1S/C48H28F2N6/c49-41-23-17-31-11-9-29-15-21-39(53-45(29)47(31)55-41)35-5-1-3-33(25-35)37-19-13-27-7-8-28-14-20-38(52-44(28)43(27)51-37)34-4-2-6-36(26-34)40-22-16-30-10-12-32-18-24-42(50)56-48(32)46(30)54-40/h1-6,9-26H,7-8H2 |
| InChIKey | OIULJOCNQHONQK-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.79 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|