C50H28N6O4 — CID 118422725
3-[9-[3-carboxy-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthrolin-2-yl]-5-(1,10-phenanthrolin-2-yl)benzoic acid (PubChem CID 118422725) has the molecular formula C50H28N6O4 and a molecular weight of 776.81 g/mol. Its IUPAC name is 3-[9-[3-carboxy-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthrolin-2-yl]-5-(1,10-phenanthrolin-2-yl)benzoic acid.
| Compound Name | 3-[9-[3-carboxy-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthrolin-2-yl]-5-(1,10-phenanthrolin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 118422725 |
| Molecular Formula | C50H28N6O4 |
| Molecular Weight | 776.81 g/mol |
| Exact Mass | 776.22 |
| IUPAC Name | 3-[9-[3-carboxy-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthrolin-2-yl]-5-(1,10-phenanthrolin-2-yl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc3ccc4cccnc4c3n2)cc(-c2ccc3ccc4ccc(-c5cc(C(=O)O)cc(-c6ccc7ccc8cccnc8c7n6)c5)nc4c3n2)c1 |
| InChI | InChI=1S/C50H28N6O4/c57-49(58)37-23-33(39-15-11-29-7-5-27-3-1-19-51-43(27)45(29)53-39)21-35(25-37)41-17-13-31-9-10-32-14-18-42(56-48(32)47(31)55-41)36-22-34(24-38(26-36)50(59)60)40-16-12-30-8-6-28-4-2-20-52-44(28)46(30)54-40/h1-26H,(H,57,58)(H,59,60) |
| InChIKey | GTBLAJAQQJNHHZ-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.81 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|