About 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile
2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile (PubChem CID 118422938) has the molecular formula C9H14F2N4O2
and a molecular weight of 248.23 g/mol. Its IUPAC name is 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile.
Molecular Properties
| Compound Name | 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile |
| PubChem CID | 118422938 |
| Molecular Formula | C9H14F2N4O2 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile |
| SMILES | COCCOC(F)(F)CNC(C#N)C(N)C#N |
| InChI | InChI=1S/C9H14F2N4O2/c1-16-2-3-17-9(10,11)6-15-8(5-13)7(14)4-12/h7-8,15H,2-3,6,14H2,1H3 |
| InChIKey | INSCLNNJXPUCFG-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile?
The IUPAC name of 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile (CID 118422938) is 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile.
What is the SMILES notation for 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile?
The canonical SMILES for 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile is COCCOC(F)(F)CNC(C#N)C(N)C#N.
What is the InChIKey of 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile?
The InChIKey is INSCLNNJXPUCFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N4O2/c1-16-2-3-17-9(10,11)6-15-8(5-13)7(14)4-12/h7-8,15H,2-3,6,14H2,1H3.
What are the key properties of 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile?
2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile has a molecular weight of 248.23 g/mol, XLogP of -0.43, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[[2,2-difluoro-2-(2-methoxyethoxy)ethyl]amino]butanedinitrile is sourced from PubChem (CID 118422938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).