C7H13N3 — CID 118422994
N,2,6-trimethyl-1,4-dihydropyrimidin-5-amine (PubChem CID 118422994) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is N,2,6-trimethyl-1,4-dihydropyrimidin-5-amine.
| Compound Name | N,2,6-trimethyl-1,4-dihydropyrimidin-5-amine |
|---|---|
| PubChem CID | 118422994 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N,2,6-trimethyl-1,4-dihydropyrimidin-5-amine |
| SMILES | CNC1=C(C)NC(C)=NC1 |
| InChI | InChI=1S/C7H13N3/c1-5-7(8-3)4-9-6(2)10-5/h8H,4H2,1-3H3,(H,9,10) |
| InChIKey | YVHYVNMLUAJYHD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |