About N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide
N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide (PubChem CID 11842333) has the molecular formula C24H29N3O3S
and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide |
| PubChem CID | 11842333 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide |
| SMILES | CCCC(C(=O)n1nc(C)cc1C)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-5-9-22(24(28)27-19(4)16-18(3)25-27)23(20-10-7-6-8-11-20)26-31(29,30)21-14-12-17(2)13-15-21/h6-8,10-16,22-23,26H,5,9H2,1-4H3 |
| InChIKey | XVDOZMYITBYVON-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide (CID 11842333) is N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide is CCCC(C(=O)n1nc(C)cc1C)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1.
What is the InChIKey of N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide?
The InChIKey is XVDOZMYITBYVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O3S/c1-5-9-22(24(28)27-19(4)16-18(3)25-27)23(20-10-7-6-8-11-20)26-31(29,30)21-14-12-17(2)13-15-21/h6-8,10-16,22-23,26H,5,9H2,1-4H3.
What are the key properties of N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide?
N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide has a molecular weight of 439.58 g/mol, XLogP of 4.58, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dimethylpyrazole-1-carbonyl)-1-phenylpentyl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 11842333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).