About 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene
3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene (PubChem CID 118423664) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene.
Analyze 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene?
The IUPAC name of 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene (CID 118423664) is 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene.
What is the SMILES notation for 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene?
The canonical SMILES for 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene is c1cc2c3c(c1)OCN3CCC2.
What is the InChIKey of 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene?
The InChIKey is JYQSSULTICTXOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-3-8-4-2-6-11-7-12-9(5-1)10(8)11/h1,3,5H,2,4,6-7H2.
What are the key properties of 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene?
3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene has a molecular weight of 161.20 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene is sourced from PubChem (CID 118423664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).