C19H25N6O10P — CID 118423955
(2,5-dioxopyrrol-1-yl) 3-[[2-(2-azidoethoxy)ethyl-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phosphoryl]-methylamino]propanoate (PubChem CID 118423955) has the molecular formula C19H25N6O10P and a molecular weight of 528.42 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 3-[[2-(2-azidoethoxy)ethyl-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phosphoryl]-methylamino]propanoate.
| Compound Name | (2,5-dioxopyrrol-1-yl) 3-[[2-(2-azidoethoxy)ethyl-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phosphoryl]-methylamino]propanoate |
|---|---|
| PubChem CID | 118423955 |
| Molecular Formula | C19H25N6O10P |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 3-[[2-(2-azidoethoxy)ethyl-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phosphoryl]-methylamino]propanoate |
| SMILES | CN(CCC(=O)ON1C(=O)C=CC1=O)P(=O)(CCOCCN=[N+]=[N-])CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H25N6O10P/c1-23(9-6-18(30)34-24-14(26)2-3-15(24)27)36(32,13-11-33-10-8-21-22-20)12-7-19(31)35-25-16(28)4-5-17(25)29/h2-3H,4-13H2,1H3 |
| InChIKey | WQGMYNQZGLAIOU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 205.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|