C19H14ClF2N5O3 — CID 118424117
4-N-[4-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-5-N-methyl-1H-imidazole-4,5-dicarboxamide (PubChem CID 118424117) has the molecular formula C19H14ClF2N5O3 and a molecular weight of 433.80 g/mol. Its IUPAC name is 4-N-[4-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-5-N-methyl-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 4-N-[4-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-5-N-methyl-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 118424117 |
| Molecular Formula | C19H14ClF2N5O3 |
| Molecular Weight | 433.80 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 4-N-[4-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-5-N-methyl-1H-imidazole-4,5-dicarboxamide |
| SMILES | CNC(=O)c1[nH]cnc1C(=O)Nc1ccc(NC(=O)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C19H14ClF2N5O3/c1-23-18(29)15-16(25-8-24-15)19(30)27-10-4-2-9(3-5-10)26-17(28)11-6-13(21)14(22)7-12(11)20/h2-8H,1H3,(H,23,29)(H,24,25)(H,26,28)(H,27,30) |
| InChIKey | GLUWCSZACPLERT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|